C24H23F3N2OS2 — CID 22891382
9-[5-(1,3-thiazol-2-ylsulfanyl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891382) has the molecular formula C24H23F3N2OS2 and a molecular weight of 476.59 g/mol. Its IUPAC name is 9-[5-(1,3-thiazol-2-ylsulfanyl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-(1,3-thiazol-2-ylsulfanyl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891382 |
| Molecular Formula | C24H23F3N2OS2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 9-[5-(1,3-thiazol-2-ylsulfanyl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCCSc2nccs2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H23F3N2OS2/c25-24(26,27)16-29-21(30)23(12-6-1-7-14-31-22-28-13-15-32-22)19-10-4-2-8-17(19)18-9-3-5-11-20(18)23/h2-5,8-11,13,15H,1,6-7,12,14,16H2,(H,29,30) |
| InChIKey | LNVFIVNSNVKEGJ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|