C24H21F3N3O2+ — CID 22891569
N-(5-methoxy-1,2-dimethyl-3H-benzimidazol-1-ium-4-yl)-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 22891569) has the molecular formula C24H21F3N3O2+ and a molecular weight of 440.45 g/mol. Its IUPAC name is N-(5-methoxy-1,2-dimethyl-3H-benzimidazol-1-ium-4-yl)-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-(5-methoxy-1,2-dimethyl-3H-benzimidazol-1-ium-4-yl)-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 22891569 |
| Molecular Formula | C24H21F3N3O2+ |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-(5-methoxy-1,2-dimethyl-3H-benzimidazol-1-ium-4-yl)-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccc2c([nH]c(C)[n+]2C)c1NC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F3N3O2/c1-14-28-21-19(30(14)2)12-13-20(32-3)22(21)29-23(31)18-7-5-4-6-17(18)15-8-10-16(11-9-15)24(25,26)27/h4-13H,1-3H3,(H,29,31)/p+1 |
| InChIKey | VDDFIOTWBRZAQK-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|