C29H33F3N4O2S — CID 22891621
N,N-diethyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide (PubChem CID 22891621) has the molecular formula C29H33F3N4O2S and a molecular weight of 558.67 g/mol. Its IUPAC name is N,N-diethyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide.
| Compound Name | N,N-diethyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 22891621 |
| Molecular Formula | C29H33F3N4O2S |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | N,N-diethyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnc(SCCCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)[nH]1 |
| InChI | InChI=1S/C29H33F3N4O2S/c1-3-36(4-2)25(37)24-18-33-27(35-24)39-17-11-5-10-16-28(26(38)34-19-29(30,31)32)22-14-8-6-12-20(22)21-13-7-9-15-23(21)28/h6-9,12-15,18H,3-5,10-11,16-17,19H2,1-2H3,(H,33,35)(H,34,38) |
| InChIKey | WFILMOPUGVGXHO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|