About CID 22891726
CID 22891726 (PubChem CID 22891726) has the molecular formula C4H17F3O15Si14
and a molecular weight of 755.36 g/mol.
Molecular Properties
| Compound Name | CID 22891726 |
| PubChem CID | 22891726 |
| Molecular Formula | C4H17F3O15Si14 |
| Molecular Weight | 755.36 g/mol |
| Exact Mass | 753.73 |
| IUPAC Name | — |
| SMILES | C[Si](O)(CCC(F)(F)F)O[Si](O[Si](O[Si]O)([Si]O)[Si]O)([Si](O[Si]O)([Si]O)[Si]O)[Si](O[Si]O)([Si]O)[Si]O |
| InChI | InChI=1S/C4H17F3O15Si14/c1-32(17,3-2-4(5,6)7)21-34(35(28-13,29-14)19-24-9,36(30-15,31-16)20-25-10)22-33(26-11,27-12)18-23-8/h8-17H,2-3H2,1H3 |
| InChIKey | CURAKXFIUCBFTK-UHFFFAOYSA-N |
| XLogP | -8.75 |
| TPSA | 248.45 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 755.36 |
| LogP ≤ 5 | -8.75 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22891726 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22891726?
The IUPAC name of CID 22891726 (CID 22891726) is not available.
What is the SMILES notation for CID 22891726?
The canonical SMILES for CID 22891726 is C[Si](O)(CCC(F)(F)F)O[Si](O[Si](O[Si]O)([Si]O)[Si]O)([Si](O[Si]O)([Si]O)[Si]O)[Si](O[Si]O)([Si]O)[Si]O.
What is the InChIKey of CID 22891726?
The InChIKey is CURAKXFIUCBFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H17F3O15Si14/c1-32(17,3-2-4(5,6)7)21-34(35(28-13,29-14)19-24-9,36(30-15,31-16)20-25-10)22-33(26-11,27-12)18-23-8/h8-17H,2-3H2,1H3.
What are the key properties of CID 22891726?
CID 22891726 has a molecular weight of 755.36 g/mol, XLogP of -8.75, 20 rotatable bonds, 10 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22891726 is sourced from PubChem (CID 22891726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).