About 4-ethenyl-2-ethoxy-1,3-dioxolane
4-ethenyl-2-ethoxy-1,3-dioxolane (PubChem CID 22891802) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 4-ethenyl-2-ethoxy-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-ethenyl-2-ethoxy-1,3-dioxolane |
| PubChem CID | 22891802 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 4-ethenyl-2-ethoxy-1,3-dioxolane |
| SMILES | C=CC1COC(OCC)O1 |
| InChI | InChI=1S/C7H12O3/c1-3-6-5-9-7(10-6)8-4-2/h3,6-7H,1,4-5H2,2H3 |
| InChIKey | ZGGSTAZNZPAHTR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-2-ethoxy-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2-ethoxy-1,3-dioxolane?
The IUPAC name of 4-ethenyl-2-ethoxy-1,3-dioxolane (CID 22891802) is 4-ethenyl-2-ethoxy-1,3-dioxolane.
What is the SMILES notation for 4-ethenyl-2-ethoxy-1,3-dioxolane?
The canonical SMILES for 4-ethenyl-2-ethoxy-1,3-dioxolane is C=CC1COC(OCC)O1.
What is the InChIKey of 4-ethenyl-2-ethoxy-1,3-dioxolane?
The InChIKey is ZGGSTAZNZPAHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-6-5-9-7(10-6)8-4-2/h3,6-7H,1,4-5H2,2H3.
What are the key properties of 4-ethenyl-2-ethoxy-1,3-dioxolane?
4-ethenyl-2-ethoxy-1,3-dioxolane has a molecular weight of 144.17 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2-ethoxy-1,3-dioxolane is sourced from PubChem (CID 22891802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).