About 3-chloro-2-oxobutanoyl iodide
3-chloro-2-oxobutanoyl iodide (PubChem CID 22891979) has the molecular formula C4H4ClIO2
and a molecular weight of 246.43 g/mol. Its IUPAC name is 3-chloro-2-oxobutanoyl iodide.
Molecular Properties
| Compound Name | 3-chloro-2-oxobutanoyl iodide |
| PubChem CID | 22891979 |
| Molecular Formula | C4H4ClIO2 |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 245.89 |
| IUPAC Name | 3-chloro-2-oxobutanoyl iodide |
| SMILES | CC(Cl)C(=O)C(=O)I |
| InChI | InChI=1S/C4H4ClIO2/c1-2(5)3(7)4(6)8/h2H,1H3 |
| InChIKey | YVXYERYMFZLOHP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-oxobutanoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-oxobutanoyl iodide?
The IUPAC name of 3-chloro-2-oxobutanoyl iodide (CID 22891979) is 3-chloro-2-oxobutanoyl iodide.
What is the SMILES notation for 3-chloro-2-oxobutanoyl iodide?
The canonical SMILES for 3-chloro-2-oxobutanoyl iodide is CC(Cl)C(=O)C(=O)I.
What is the InChIKey of 3-chloro-2-oxobutanoyl iodide?
The InChIKey is YVXYERYMFZLOHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClIO2/c1-2(5)3(7)4(6)8/h2H,1H3.
What are the key properties of 3-chloro-2-oxobutanoyl iodide?
3-chloro-2-oxobutanoyl iodide has a molecular weight of 246.43 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-oxobutanoyl iodide is sourced from PubChem (CID 22891979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).