C23H48N4 — CID 22892299
N-methyl-N'-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine (PubChem CID 22892299) has the molecular formula C23H48N4 and a molecular weight of 380.67 g/mol. Its IUPAC name is N-methyl-N'-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine.
| Compound Name | N-methyl-N'-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
|---|---|
| PubChem CID | 22892299 |
| Molecular Formula | C23H48N4 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 380.39 |
| IUPAC Name | N-methyl-N'-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
| SMILES | CCCN(CN(C)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H48N4/c1-11-12-27(19-15-22(6,7)25-23(8,9)16-19)17-26(10)18-13-20(2,3)24-21(4,5)14-18/h18-19,24-25H,11-17H2,1-10H3 |
| InChIKey | XYEUSLJACXXWBK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|