C24H34N6O6+2 — CID 22892424
6,10-diisocyanato-17-(6-isocyanatohexyl)-17-aza-7,9-diazoniadispiro[6.1.69.37]octadecane-8,16,18-trione (PubChem CID 22892424) has the molecular formula C24H34N6O6+2 and a molecular weight of 502.57 g/mol. Its IUPAC name is 6,10-diisocyanato-17-(6-isocyanatohexyl)-17-aza-7,9-diazoniadispiro[6.1.69.37]octadecane-8,16,18-trione.
| Compound Name | 6,10-diisocyanato-17-(6-isocyanatohexyl)-17-aza-7,9-diazoniadispiro[6.1.69.37]octadecane-8,16,18-trione |
|---|---|
| PubChem CID | 22892424 |
| Molecular Formula | C24H34N6O6+2 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 6,10-diisocyanato-17-(6-isocyanatohexyl)-17-aza-7,9-diazoniadispiro[6.1.69.37]octadecane-8,16,18-trione |
| SMILES | O=C=NCCCCCCN1C(=O)[N+]2(CCCCCC2N=C=O)C(=O)[N+]2(CCCCCC2N=C=O)C1=O |
| InChI | InChI=1S/C24H34N6O6/c31-17-25-13-7-1-2-8-14-28-22(34)29(15-9-3-5-11-20(29)26-18-32)24(36)30(23(28)35)16-10-4-6-12-21(30)27-19-33/h20-21H,1-16H2/q+2 |
| InChIKey | ZQUKLLCNOBXAPP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|