C8H8N2S — CID 22892590
4-ethylthieno[3,4-d]pyridazine (PubChem CID 22892590) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is 4-ethylthieno[3,4-d]pyridazine.
| Compound Name | 4-ethylthieno[3,4-d]pyridazine |
|---|---|
| PubChem CID | 22892590 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 4-ethylthieno[3,4-d]pyridazine |
| SMILES | CCc1nncc2cscc12 |
| InChI | InChI=1S/C8H8N2S/c1-2-8-7-5-11-4-6(7)3-9-10-8/h3-5H,2H2,1H3 |
| InChIKey | LLUYKRUYFJBAOF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |