C23H25NO3 — CID 22893072
1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethanone (PubChem CID 22893072) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethanone.
| Compound Name | 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 22893072 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethanone |
| SMILES | COc1cc2c(cc1OC)[C@H]1CCCC[C@H]1N=C2c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C23H25NO3/c1-14(25)15-7-6-8-16(11-15)23-19-13-22(27-3)21(26-2)12-18(19)17-9-4-5-10-20(17)24-23/h6-8,11-13,17,20H,4-5,9-10H2,1-3H3/t17-,20-/m1/s1 |
| InChIKey | ABOZOQNLIABXJQ-YLJYHZDGSA-N |
| XLogP | 4.78 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |