C33H38N2O — CID 22894455
3',3',4',6'-tetramethyl-1'-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)spiro[benzo[f][1,4]benzoxazine-3,2'-indole] (PubChem CID 22894455) has the molecular formula C33H38N2O and a molecular weight of 478.68 g/mol. Its IUPAC name is 3',3',4',6'-tetramethyl-1'-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)spiro[benzo[f][1,4]benzoxazine-3,2'-indole].
| Compound Name | 3',3',4',6'-tetramethyl-1'-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)spiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
|---|---|
| PubChem CID | 22894455 |
| Molecular Formula | C33H38N2O |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 3',3',4',6'-tetramethyl-1'-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)spiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
| SMILES | Cc1cc(C)c2c(c1)N(C1CC3CCC1(C)C3(C)C)C1(C=Nc3c(ccc4ccccc34)O1)C2(C)C |
| InChI | InChI=1S/C33H38N2O/c1-20-16-21(2)28-25(17-20)35(27-18-23-14-15-32(27,7)30(23,3)4)33(31(28,5)6)19-34-29-24-11-9-8-10-22(24)12-13-26(29)36-33/h8-13,16-17,19,23,27H,14-15,18H2,1-7H3 |
| InChIKey | VWGNINMSENGJMV-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |