About [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol
[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 22894643) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| PubChem CID | 22894643 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | [C-]#[N+]c1ccc(C2=NOC(CO)C2)cc1 |
| InChI | InChI=1S/C11H10N2O2/c1-12-9-4-2-8(3-5-9)11-6-10(7-14)15-13-11/h2-5,10,14H,6-7H2 |
| InChIKey | JXJDVXXVGVQAAP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The IUPAC name of [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (CID 22894643) is [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol is [C-]#[N+]c1ccc(C2=NOC(CO)C2)cc1.
What is the InChIKey of [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The InChIKey is JXJDVXXVGVQAAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-12-9-4-2-8(3-5-9)11-6-10(7-14)15-13-11/h2-5,10,14H,6-7H2.
What are the key properties of [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol has a molecular weight of 202.21 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 22894643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).