About ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate
ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate (PubChem CID 22894670) has the molecular formula C19H22N4O4
and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate |
| PubChem CID | 22894670 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate |
| SMILES | [C-]#[N+]c1ccc(C2=NOC(CN3CCN(CC(=O)OCC)C(=O)C3)C2)cc1 |
| InChI | InChI=1S/C19H22N4O4/c1-3-26-19(25)13-23-9-8-22(12-18(23)24)11-16-10-17(21-27-16)14-4-6-15(20-2)7-5-14/h4-7,16H,3,8-13H2,1H3 |
| InChIKey | RKHIRPOBSQILMZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate?
The IUPAC name of ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate (CID 22894670) is ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate.
What is the SMILES notation for ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate?
The canonical SMILES for ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate is [C-]#[N+]c1ccc(C2=NOC(CN3CCN(CC(=O)OCC)C(=O)C3)C2)cc1.
What is the InChIKey of ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate?
The InChIKey is RKHIRPOBSQILMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O4/c1-3-26-19(25)13-23-9-8-22(12-18(23)24)11-16-10-17(21-27-16)14-4-6-15(20-2)7-5-14/h4-7,16H,3,8-13H2,1H3.
What are the key properties of ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate?
ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate has a molecular weight of 370.41 g/mol, XLogP of 1.44, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[[3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-oxopiperazin-1-yl]acetate is sourced from PubChem (CID 22894670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).