About methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate
methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate (PubChem CID 22894876) has the molecular formula C21H22F2N2O5
and a molecular weight of 420.41 g/mol. Its IUPAC name is methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate.
Molecular Properties
| Compound Name | methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate |
| PubChem CID | 22894876 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate |
| SMILES | COC(=O)CN(C(=O)[C@H](C)NC(=O)Cc1cc(F)cc(F)c1)c1ccccc1OC |
| InChI | InChI=1S/C21H22F2N2O5/c1-13(24-19(26)10-14-8-15(22)11-16(23)9-14)21(28)25(12-20(27)30-3)17-6-4-5-7-18(17)29-2/h4-9,11,13H,10,12H2,1-3H3,(H,24,26)/t13-/m0/s1 |
| InChIKey | DRNAKNOGKWUCEQ-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate?
The IUPAC name of methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate (CID 22894876) is methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate.
What is the SMILES notation for methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate?
The canonical SMILES for methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate is COC(=O)CN(C(=O)[C@H](C)NC(=O)Cc1cc(F)cc(F)c1)c1ccccc1OC.
What is the InChIKey of methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate?
The InChIKey is DRNAKNOGKWUCEQ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C21H22F2N2O5/c1-13(24-19(26)10-14-8-15(22)11-16(23)9-14)21(28)25(12-20(27)30-3)17-6-4-5-7-18(17)29-2/h4-9,11,13H,10,12H2,1-3H3,(H,24,26)/t13-/m0/s1.
What are the key properties of methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate?
methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate has a molecular weight of 420.41 g/mol, XLogP of 2.23, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(N-[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]-2-methoxyanilino)acetate is sourced from PubChem (CID 22894876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).