C10H18N2S — CID 22895099
3-(isothiocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine (PubChem CID 22895099) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 3-(isothiocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine.
| Compound Name | 3-(isothiocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 22895099 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3-(isothiocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine |
| SMILES | CC1(C)CC(CN=C=S)C(C)(C)N1 |
| InChI | InChI=1S/C10H18N2S/c1-9(2)5-8(6-11-7-13)10(3,4)12-9/h8,12H,5-6H2,1-4H3 |
| InChIKey | VAMTXBFILWKBMB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|