C10H21FNO2P — CID 22895100
4-[fluoro(methyl)phosphoryl]oxy-2,2,6,6-tetramethylpiperidine (PubChem CID 22895100) has the molecular formula C10H21FNO2P and a molecular weight of 237.25 g/mol. Its IUPAC name is 4-[fluoro(methyl)phosphoryl]oxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[fluoro(methyl)phosphoryl]oxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 22895100 |
| Molecular Formula | C10H21FNO2P |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4-[fluoro(methyl)phosphoryl]oxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(OP(C)(=O)F)CC(C)(C)N1 |
| InChI | InChI=1S/C10H21FNO2P/c1-9(2)6-8(14-15(5,11)13)7-10(3,4)12-9/h8,12H,6-7H2,1-5H3 |
| InChIKey | ZSHVOISPAFOIPF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|