C33H32FNO3 — CID 22895159
1-[4-[2-(2-fluorophenyl)-8,10-dimethoxy-6-methylbenzo[h]chromen-2-yl]phenyl]piperidine (PubChem CID 22895159) has the molecular formula C33H32FNO3 and a molecular weight of 509.62 g/mol. Its IUPAC name is 1-[4-[2-(2-fluorophenyl)-8,10-dimethoxy-6-methylbenzo[h]chromen-2-yl]phenyl]piperidine.
| Compound Name | 1-[4-[2-(2-fluorophenyl)-8,10-dimethoxy-6-methylbenzo[h]chromen-2-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 22895159 |
| Molecular Formula | C33H32FNO3 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 1-[4-[2-(2-fluorophenyl)-8,10-dimethoxy-6-methylbenzo[h]chromen-2-yl]phenyl]piperidine |
| SMILES | COc1cc(OC)c2c3c(cc(C)c2c1)C=CC(c1ccc(N2CCCCC2)cc1)(c1ccccc1F)O3 |
| InChI | InChI=1S/C33H32FNO3/c1-22-19-23-15-16-33(28-9-5-6-10-29(28)34,24-11-13-25(14-12-24)35-17-7-4-8-18-35)38-32(23)31-27(22)20-26(36-2)21-30(31)37-3/h5-6,9-16,19-21H,4,7-8,17-18H2,1-3H3 |
| InChIKey | BIRRDIOUTPUVJI-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|