C20H22O10 — CID 22895394
6-(3,4,5-trihydroxybenzoyl)oxyhexyl 3,4,5-trihydroxybenzoate (PubChem CID 22895394) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is 6-(3,4,5-trihydroxybenzoyl)oxyhexyl 3,4,5-trihydroxybenzoate.
| Compound Name | 6-(3,4,5-trihydroxybenzoyl)oxyhexyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 22895394 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 6-(3,4,5-trihydroxybenzoyl)oxyhexyl 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OCCCCCCOC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C20H22O10/c21-13-7-11(8-14(22)17(13)25)19(27)29-5-3-1-2-4-6-30-20(28)12-9-15(23)18(26)16(24)10-12/h7-10,21-26H,1-6H2 |
| InChIKey | KKMQNWAUGKFRNL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|