About 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate
2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate (PubChem CID 22895824) has the molecular formula C12H13O5S-
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate |
| PubChem CID | 22895824 |
| Molecular Formula | C12H13O5S- |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate |
| SMILES | COC1=c2ccccc2=C(S(=O)(=O)[O-])C(OC)C1 |
| InChI | InChI=1S/C12H14O5S/c1-16-10-7-11(17-2)12(18(13,14)15)9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3,(H,13,14,15)/p-1 |
| InChIKey | GOJHSBPDERNEOW-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate?
The IUPAC name of 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate (CID 22895824) is 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate.
What is the SMILES notation for 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate?
The canonical SMILES for 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate is COC1=c2ccccc2=C(S(=O)(=O)[O-])C(OC)C1.
What is the InChIKey of 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate?
The InChIKey is GOJHSBPDERNEOW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H14O5S/c1-16-10-7-11(17-2)12(18(13,14)15)9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3,(H,13,14,15)/p-1.
What are the key properties of 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate?
2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate has a molecular weight of 269.30 g/mol, XLogP of -0.49, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonate is sourced from PubChem (CID 22895824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).