C15H13N3O7 — CID 2289598
dimethyl 5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzene-1,3-dicarboxylate (PubChem CID 2289598) has the molecular formula C15H13N3O7 and a molecular weight of 347.28 g/mol. Its IUPAC name is dimethyl 5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2289598 |
| Molecular Formula | C15H13N3O7 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | dimethyl 5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=C/c2c(O)[nH]c(=O)[nH]c2=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C15H13N3O7/c1-24-13(21)7-3-8(14(22)25-2)5-9(4-7)16-6-10-11(19)17-15(23)18-12(10)20/h3-6H,1-2H3,(H3,17,18,19,20,23)/b16-6+ |
| InChIKey | HMUCWQVLQRSSAS-OMCISZLKSA-N |
| XLogP | 0.09 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|