C44H66N6O4 — CID 22896039
[2-[3-(2-hexyldecanoylamino)-4-methylphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate (PubChem CID 22896039) has the molecular formula C44H66N6O4 and a molecular weight of 743.05 g/mol. Its IUPAC name is [2-[3-(2-hexyldecanoylamino)-4-methylphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate.
| Compound Name | [2-[3-(2-hexyldecanoylamino)-4-methylphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 22896039 |
| Molecular Formula | C44H66N6O4 |
| Molecular Weight | 743.05 g/mol |
| Exact Mass | 742.51 |
| IUPAC Name | [2-[3-(2-hexyldecanoylamino)-4-methylphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CC(C)CC2C)c2nc(-c3ccc(C)c(NC(=O)C(CCCCCC)CCCCCCCC)c3)[nH]n2c1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C44H66N6O4/c1-8-10-12-14-15-17-19-34(18-16-13-11-9-2)42(51)46-38-28-35(21-20-31(38)4)40-47-41-37(29-36-32(5)26-30(3)27-33(36)6)39(45-7)43(50(41)48-40)54-44(52)49-22-24-53-25-23-49/h20-21,28,30,32-34,36H,8-19,22-27,29H2,1-6H3,(H,46,51)(H,47,48) |
| InChIKey | GFURUIVKYYNGPZ-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.05 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|