C26H32N4O4 — CID 22896054
[6-isocyano-2-methyl-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethoxybenzoate (PubChem CID 22896054) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is [6-isocyano-2-methyl-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethoxybenzoate.
| Compound Name | [6-isocyano-2-methyl-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 22896054 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [6-isocyano-2-methyl-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethoxybenzoate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CC(C)CC2C)c2nc(C)[nH]n2c1OC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C26H32N4O4/c1-14-11-15(2)18(16(3)12-14)13-19-23(27-5)25(30-24(19)28-17(4)29-30)34-26(31)22-20(32-6)9-8-10-21(22)33-7/h8-10,14-16,18H,11-13H2,1-4,6-7H3,(H,28,29) |
| InChIKey | JXBMCZXNHZMXOR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|