C28H35N5O3 — CID 22896058
[6-isocyano-2-(4-methylphenyl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate (PubChem CID 22896058) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is [6-isocyano-2-(4-methylphenyl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate.
| Compound Name | [6-isocyano-2-(4-methylphenyl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 22896058 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | [6-isocyano-2-(4-methylphenyl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CC(C)CC2C)c2nc(-c3ccc(C)cc3)[nH]n2c1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C28H35N5O3/c1-17-6-8-21(9-7-17)25-30-26-23(16-22-19(3)14-18(2)15-20(22)4)24(29-5)27(33(26)31-25)36-28(34)32-10-12-35-13-11-32/h6-9,18-20,22H,10-16H2,1-4H3,(H,30,31) |
| InChIKey | BBYZHVVRZKWJSD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|