About N-cycloheptyl-N'-cyclopentyloxamide
N-cycloheptyl-N'-cyclopentyloxamide (PubChem CID 2289633) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is N-cycloheptyl-N'-cyclopentyloxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-N'-cyclopentyloxamide |
| PubChem CID | 2289633 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-cycloheptyl-N'-cyclopentyloxamide |
| SMILES | O=C(NC1CCCCCC1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H24N2O2/c17-13(14(18)16-12-9-5-6-10-12)15-11-7-3-1-2-4-8-11/h11-12H,1-10H2,(H,15,17)(H,16,18) |
| InChIKey | UOXFLFBUTDOHEP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cycloheptyl-N'-cyclopentyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-N'-cyclopentyloxamide?
The IUPAC name of N-cycloheptyl-N'-cyclopentyloxamide (CID 2289633) is N-cycloheptyl-N'-cyclopentyloxamide.
What is the SMILES notation for N-cycloheptyl-N'-cyclopentyloxamide?
The canonical SMILES for N-cycloheptyl-N'-cyclopentyloxamide is O=C(NC1CCCCCC1)C(=O)NC1CCCC1.
What is the InChIKey of N-cycloheptyl-N'-cyclopentyloxamide?
The InChIKey is UOXFLFBUTDOHEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c17-13(14(18)16-12-9-5-6-10-12)15-11-7-3-1-2-4-8-11/h11-12H,1-10H2,(H,15,17)(H,16,18).
What are the key properties of N-cycloheptyl-N'-cyclopentyloxamide?
N-cycloheptyl-N'-cyclopentyloxamide has a molecular weight of 252.36 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-N'-cyclopentyloxamide is sourced from PubChem (CID 2289633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).