About Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester
Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester (PubChem CID 22896780) has the molecular formula C18H24N2O3
and a molecular weight of 316.40 g/mol. Its IUPAC name is [2-(dimethylcarbamoyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate.
Molecular Properties
| Compound Name | Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester |
| PubChem CID | 22896780 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [2-(dimethylcarbamoyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | CN1C2CCC1C(C(C2)OC(=O)C3=CC=CC=C3)C(=O)N(C)C |
| InChI | InChI=1S/C18H24N2O3/c1-19(2)17(21)16-14-10-9-13(20(14)3)11-15(16)23-18(22)12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3 |
| InChIKey | KCJKRDUKFUVPDP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 459 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester?
The IUPAC name of Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester (CID 22896780) is [2-(dimethylcarbamoyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate.
What is the SMILES notation for Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester?
The canonical SMILES for Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester is CN1C2CCC1C(C(C2)OC(=O)C3=CC=CC=C3)C(=O)N(C)C.
What is the InChIKey of Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester?
The InChIKey is KCJKRDUKFUVPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O3/c1-19(2)17(21)16-14-10-9-13(20(14)3)11-15(16)23-18(22)12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3.
What are the key properties of Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester?
Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester has a molecular weight of 316.40 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Benzoic acid 2-dimethylcarbamoyl-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester is sourced from PubChem (CID 22896780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).