C21H22ClN5O3 — CID 22896947
N-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 22896947) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 22896947 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CN1C2CCC1C(CNc1ccc([N+](=O)[O-])c3nonc13)C(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C21H22ClN5O3/c1-26-14-6-8-18(26)16(15(10-14)12-2-4-13(22)5-3-12)11-23-17-7-9-19(27(28)29)21-20(17)24-30-25-21/h2-5,7,9,14-16,18,23H,6,8,10-11H2,1H3 |
| InChIKey | NUUWTHFEFRYIIS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|