C9H11F7O3 — CID 22897551
1,1,1,2-tetrafluoro-3-(2-methoxyethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 22897551) has the molecular formula C9H11F7O3 and a molecular weight of 300.17 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-(2-methoxyethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2-tetrafluoro-3-(2-methoxyethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 22897551 |
| Molecular Formula | C9H11F7O3 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-(2-methoxyethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(F)(COCCOC)C(F)(F)F |
| InChI | InChI=1S/C9H11F7O3/c1-6(10)8(12,13)19-7(11,9(14,15)16)5-18-4-3-17-2/h1,3-5H2,2H3 |
| InChIKey | UDQPTYLJDCMGKY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|