C9H5F13O3 — CID 22897552
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol (PubChem CID 22897552) has the molecular formula C9H5F13O3 and a molecular weight of 408.11 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 22897552 |
| Molecular Formula | C9H5F13O3 |
| Molecular Weight | 408.11 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(CO)C(F)(F)F |
| InChI | InChI=1S/C9H5F13O3/c1-3(10)5(12,13)25-6(14,8(18,19)20)9(21,22)24-4(11,2-23)7(15,16)17/h23H,1-2H2 |
| InChIKey | UOELVWCFAMHMML-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.11 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |