C30H28F6O5 — CID 22898016
4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl 2-methoxybenzene-1,4-dicarboxylate (PubChem CID 22898016) has the molecular formula C30H28F6O5 and a molecular weight of 582.54 g/mol. Its IUPAC name is 4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl 2-methoxybenzene-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl 2-methoxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22898016 |
| Molecular Formula | C30H28F6O5 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl 2-methoxybenzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2c(C)cc(C(c3cc(C)c(C)c(C)c3)(C(F)(F)F)C(F)(F)F)cc2C)cc1OC |
| InChI | InChI=1S/C30H28F6O5/c1-15-10-21(11-16(2)19(15)5)28(29(31,32)33,30(34,35)36)22-12-17(3)25(18(4)13-22)41-26(37)20-8-9-23(27(38)40-7)24(14-20)39-6/h8-14H,1-7H3 |
| InChIKey | LRHHUQJCEZFTLA-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|