C33H28F6O4 — CID 22898019
4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl naphthalene-1,4-dicarboxylate (PubChem CID 22898019) has the molecular formula C33H28F6O4 and a molecular weight of 602.57 g/mol. Its IUPAC name is 4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl naphthalene-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl naphthalene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22898019 |
| Molecular Formula | C33H28F6O4 |
| Molecular Weight | 602.57 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 4-O-[4-[1,1,1,3,3,3-hexafluoro-2-(3,4,5-trimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] 1-O-methyl naphthalene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2c(C)cc(C(c3cc(C)c(C)c(C)c3)(C(F)(F)F)C(F)(F)F)cc2C)c2ccccc12 |
| InChI | InChI=1S/C33H28F6O4/c1-17-13-22(14-18(2)21(17)5)31(32(34,35)36,33(37,38)39)23-15-19(3)28(20(4)16-23)43-30(41)27-12-11-26(29(40)42-6)24-9-7-8-10-25(24)27/h7-16H,1-6H3 |
| InChIKey | FBSAJSTYFUQJCV-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.57 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|