C35H40O4 — CID 22898042
4-O-[2-cyclohexyl-4-[(3-cyclohexyl-4-methylphenyl)methyl]phenyl] 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 22898042) has the molecular formula C35H40O4 and a molecular weight of 524.70 g/mol. Its IUPAC name is 4-O-[2-cyclohexyl-4-[(3-cyclohexyl-4-methylphenyl)methyl]phenyl] 1-O-methyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-cyclohexyl-4-[(3-cyclohexyl-4-methylphenyl)methyl]phenyl] 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22898042 |
| Molecular Formula | C35H40O4 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 4-O-[2-cyclohexyl-4-[(3-cyclohexyl-4-methylphenyl)methyl]phenyl] 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2ccc(Cc3ccc(C)c(C4CCCCC4)c3)cc2C2CCCCC2)cc1 |
| InChI | InChI=1S/C35H40O4/c1-24-13-14-25(22-31(24)27-9-5-3-6-10-27)21-26-15-20-33(32(23-26)28-11-7-4-8-12-28)39-35(37)30-18-16-29(17-19-30)34(36)38-2/h13-20,22-23,27-28H,3-12,21H2,1-2H3 |
| InChIKey | ORDSIRKIHASGJI-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|