C28H21F9O5 — CID 22898052
4-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl 2-(trifluoromethoxy)benzene-1,4-dicarboxylate (PubChem CID 22898052) has the molecular formula C28H21F9O5 and a molecular weight of 608.45 g/mol. Its IUPAC name is 4-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl 2-(trifluoromethoxy)benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl 2-(trifluoromethoxy)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22898052 |
| Molecular Formula | C28H21F9O5 |
| Molecular Weight | 608.45 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | 4-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl 2-(trifluoromethoxy)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2ccc(C(c3ccc(C)c(C)c3)(C(F)(F)F)C(F)(F)F)cc2C)cc1OC(F)(F)F |
| InChI | InChI=1S/C28H21F9O5/c1-14-5-7-18(11-15(14)2)25(26(29,30)31,27(32,33)34)19-8-10-21(16(3)12-19)41-23(38)17-6-9-20(24(39)40-4)22(13-17)42-28(35,36)37/h5-13H,1-4H3 |
| InChIKey | GGUPBIZUFVGXSW-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.45 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|