C27H22F6O4 — CID 22898053
3-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate (PubChem CID 22898053) has the molecular formula C27H22F6O4 and a molecular weight of 524.46 g/mol. Its IUPAC name is 3-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate.
| Compound Name | 3-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22898053 |
| Molecular Formula | C27H22F6O4 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 3-O-[4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cccc(C(=O)Oc2ccc(C(c3ccc(C)c(C)c3)(C(F)(F)F)C(F)(F)F)cc2C)c1 |
| InChI | InChI=1S/C27H22F6O4/c1-15-8-9-20(12-16(15)2)25(26(28,29)30,27(31,32)33)21-10-11-22(17(3)13-21)37-24(35)19-7-5-6-18(14-19)23(34)36-4/h5-14H,1-4H3 |
| InChIKey | KDLMMPYTSJIKGR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|