C24H34O8 — CID 22898114
2-(1,3-dioxan-2-yl)ethyl 2-[5-(1-hydroxyethenyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate (PubChem CID 22898114) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)ethyl 2-[5-(1-hydroxyethenyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate.
| Compound Name | 2-(1,3-dioxan-2-yl)ethyl 2-[5-(1-hydroxyethenyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate |
|---|---|
| PubChem CID | 22898114 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)ethyl 2-[5-(1-hydroxyethenyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate |
| SMILES | C=C(O)C1CC2CC1C(C)C2C(CC1C(=O)OC(=O)C1C)C(=O)OCCC1OCCCO1 |
| InChI | InChI=1S/C24H34O8/c1-12-16-9-15(10-18(16)14(3)25)21(12)19(11-17-13(2)22(26)32-24(17)28)23(27)31-8-5-20-29-6-4-7-30-20/h12-13,15-21,25H,3-11H2,1-2H3 |
| InChIKey | FYMCMJKINQJCOW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|