C18H17N3O8 — CID 22898494
(2S)-2-[bis[(4-nitrophenyl)methyl]amino]butanedioic acid (PubChem CID 22898494) has the molecular formula C18H17N3O8 and a molecular weight of 403.35 g/mol. Its IUPAC name is (2S)-2-[bis[(4-nitrophenyl)methyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[bis[(4-nitrophenyl)methyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22898494 |
| Molecular Formula | C18H17N3O8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (2S)-2-[bis[(4-nitrophenyl)methyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](C(=O)O)N(Cc1ccc([N+](=O)[O-])cc1)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17N3O8/c22-17(23)9-16(18(24)25)19(10-12-1-5-14(6-2-12)20(26)27)11-13-3-7-15(8-4-13)21(28)29/h1-8,16H,9-11H2,(H,22,23)(H,24,25)/t16-/m0/s1 |
| InChIKey | AOOUDFCODVXDIV-INIZCTEOSA-N |
| XLogP | 2.43 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|