C13H20N2 — CID 22898575
N-(2,3-dihydro-1H-indol-5-ylmethyl)-N-ethylethanamine (PubChem CID 22898575) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-ylmethyl)-N-ethylethanamine.
| Compound Name | N-(2,3-dihydro-1H-indol-5-ylmethyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 22898575 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-ylmethyl)-N-ethylethanamine |
| SMILES | CCN(CC)Cc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C13H20N2/c1-3-15(4-2)10-11-5-6-13-12(9-11)7-8-14-13/h5-6,9,14H,3-4,7-8,10H2,1-2H3 |
| InChIKey | MUDCGMWHPDNAHF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |