C9H15N3O3 — CID 22898686
2-methyl-N-[5-(methylperoxymethyl)-1H-pyrazol-3-yl]propanamide (PubChem CID 22898686) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-methyl-N-[5-(methylperoxymethyl)-1H-pyrazol-3-yl]propanamide.
| Compound Name | 2-methyl-N-[5-(methylperoxymethyl)-1H-pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 22898686 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-methyl-N-[5-(methylperoxymethyl)-1H-pyrazol-3-yl]propanamide |
| SMILES | COOCc1cc(NC(=O)C(C)C)n[nH]1 |
| InChI | InChI=1S/C9H15N3O3/c1-6(2)9(13)10-8-4-7(11-12-8)5-15-14-3/h4,6H,5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | CRAMGCUOUJNSNX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|