About N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine
N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 22899275) has the molecular formula C4H7N3OS
and a molecular weight of 145.19 g/mol. Its IUPAC name is N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 22899275 |
| Molecular Formula | C4H7N3OS |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CONc1nnc(C)s1 |
| InChI | InChI=1S/C4H7N3OS/c1-3-5-6-4(9-3)7-8-2/h1-2H3,(H,6,7) |
| InChIKey | BZOXLKPOLIDESX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine (CID 22899275) is N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine is CONc1nnc(C)s1.
What is the InChIKey of N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine?
The InChIKey is BZOXLKPOLIDESX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3OS/c1-3-5-6-4(9-3)7-8-2/h1-2H3,(H,6,7).
What are the key properties of N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine?
N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine has a molecular weight of 145.19 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-5-methyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 22899275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).