About 2-butan-2-yl-4,5-diisocyano-1H-imidazole
2-butan-2-yl-4,5-diisocyano-1H-imidazole (PubChem CID 22899304) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 2-butan-2-yl-4,5-diisocyano-1H-imidazole.
Molecular Properties
| Compound Name | 2-butan-2-yl-4,5-diisocyano-1H-imidazole |
| PubChem CID | 22899304 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-butan-2-yl-4,5-diisocyano-1H-imidazole |
| SMILES | [C-]#[N+]c1nc(C(C)CC)[nH]c1[N+]#[C-] |
| InChI | InChI=1S/C9H10N4/c1-5-6(2)7-12-8(10-3)9(11-4)13-7/h6H,5H2,1-2H3,(H,12,13) |
| InChIKey | ANKHJRUHSJZRPN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yl-4,5-diisocyano-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-4,5-diisocyano-1H-imidazole?
The IUPAC name of 2-butan-2-yl-4,5-diisocyano-1H-imidazole (CID 22899304) is 2-butan-2-yl-4,5-diisocyano-1H-imidazole.
What is the SMILES notation for 2-butan-2-yl-4,5-diisocyano-1H-imidazole?
The canonical SMILES for 2-butan-2-yl-4,5-diisocyano-1H-imidazole is [C-]#[N+]c1nc(C(C)CC)[nH]c1[N+]#[C-].
What is the InChIKey of 2-butan-2-yl-4,5-diisocyano-1H-imidazole?
The InChIKey is ANKHJRUHSJZRPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-5-6(2)7-12-8(10-3)9(11-4)13-7/h6H,5H2,1-2H3,(H,12,13).
What are the key properties of 2-butan-2-yl-4,5-diisocyano-1H-imidazole?
2-butan-2-yl-4,5-diisocyano-1H-imidazole has a molecular weight of 174.21 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-4,5-diisocyano-1H-imidazole is sourced from PubChem (CID 22899304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).