C26H24N4O6 — CID 22900604
5-[3-[4-(diethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]benzene-1,3-dicarboxylic acid (PubChem CID 22900604) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is 5-[3-[4-(diethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[3-[4-(diethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22900604 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 5-[3-[4-(diethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]benzene-1,3-dicarboxylic acid |
| SMILES | [C-]#[N+]C1=C(C)/C(=N\c2ccc(N(CC)CC)cc2C)C(=O)N(c2cc(C(=O)O)cc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C26H24N4O6/c1-6-29(7-2)18-8-9-20(14(3)10-18)28-22-15(4)21(27-5)23(31)30(24(22)32)19-12-16(25(33)34)11-17(13-19)26(35)36/h8-13H,6-7H2,1-4H3,(H,33,34)(H,35,36)/b28-22+ |
| InChIKey | LOHUJHJFLIOAOO-XAYXJRQQSA-N |
| XLogP | 4.08 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|