About N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide
N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide (PubChem CID 22900982) has the molecular formula C8H16N2O5
and a molecular weight of 220.22 g/mol. Its IUPAC name is N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide.
Molecular Properties
| Compound Name | N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide |
| PubChem CID | 22900982 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide |
| SMILES | CNC(=O)CC(=O)NC(CO)(CO)CO |
| InChI | InChI=1S/C8H16N2O5/c1-9-6(14)2-7(15)10-8(3-11,4-12)5-13/h11-13H,2-5H2,1H3,(H,9,14)(H,10,15) |
| InChIKey | FEPKIIPLIBZTEH-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide?
The IUPAC name of N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide (CID 22900982) is N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide.
What is the SMILES notation for N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide?
The canonical SMILES for N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide is CNC(=O)CC(=O)NC(CO)(CO)CO.
What is the InChIKey of N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide?
The InChIKey is FEPKIIPLIBZTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O5/c1-9-6(14)2-7(15)10-8(3-11,4-12)5-13/h11-13H,2-5H2,1H3,(H,9,14)(H,10,15).
What are the key properties of N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide?
N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide has a molecular weight of 220.22 g/mol, XLogP of -3.05, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-N-methylpropanediamide is sourced from PubChem (CID 22900982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).