C19H31NO4Si — CID 22901354
(1S,8aR,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 22901354) has the molecular formula C19H31NO4Si and a molecular weight of 365.55 g/mol. Its IUPAC name is (1S,8aR,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | (1S,8aR,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 22901354 |
| Molecular Formula | C19H31NO4Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (1S,8aR,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C3CCCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C19H31NO4Si/c1-11(24-25(5,6)19(2,3)4)14-15-12-9-7-8-10-13(12)16(18(22)23)20(15)17(14)21/h11-12,14-15H,7-10H2,1-6H3,(H,22,23)/t11-,12-,14-,15-/m1/s1 |
| InChIKey | IDQPSZMFNZOCHU-QHSBEEBCSA-N |
| XLogP | 3.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|