About 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane
4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane (PubChem CID 22901656) has the molecular formula C16H29BO2
and a molecular weight of 264.22 g/mol. Its IUPAC name is 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane.
Molecular Properties
| Compound Name | 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane |
| PubChem CID | 22901656 |
| Molecular Formula | C16H29BO2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane |
| SMILES | CCB1OC(C2CCCCC2)C(C2CCCCC2)O1 |
| InChI | InChI=1S/C16H29BO2/c1-2-17-18-15(13-9-5-3-6-10-13)16(19-17)14-11-7-4-8-12-14/h13-16H,2-12H2,1H3 |
| InChIKey | CPSCOPNVLILSKG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane?
The IUPAC name of 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane (CID 22901656) is 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane.
What is the SMILES notation for 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane?
The canonical SMILES for 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane is CCB1OC(C2CCCCC2)C(C2CCCCC2)O1.
What is the InChIKey of 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane?
The InChIKey is CPSCOPNVLILSKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29BO2/c1-2-17-18-15(13-9-5-3-6-10-13)16(19-17)14-11-7-4-8-12-14/h13-16H,2-12H2,1H3.
What are the key properties of 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane?
4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane has a molecular weight of 264.22 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane is sourced from PubChem (CID 22901656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).