C27H29F3O6S2 — CID 22901789
bis(4-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 22901789) has the molecular formula C27H29F3O6S2 and a molecular weight of 570.65 g/mol. Its IUPAC name is bis(4-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | bis(4-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22901789 |
| Molecular Formula | C27H29F3O6S2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | bis(4-methylphenyl)-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C26H29O3S.CHF3O3S/c1-19-6-12-22(13-7-19)30(23-14-8-20(2)9-15-23)24-16-10-21(11-17-24)28-18-25(27)29-26(3,4)5;2-1(3,4)8(5,6)7/h6-17H,18H2,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | XJNGAKIGYASKFW-UHFFFAOYSA-M |
| XLogP | 6.17 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|