C10H24N2O3 — CID 22901827
2-[2-(2-butoxyethoxy)ethoxy]ethane-1,1-diamine (PubChem CID 22901827) has the molecular formula C10H24N2O3 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)ethoxy]ethane-1,1-diamine.
| Compound Name | 2-[2-(2-butoxyethoxy)ethoxy]ethane-1,1-diamine |
|---|---|
| PubChem CID | 22901827 |
| Molecular Formula | C10H24N2O3 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)ethoxy]ethane-1,1-diamine |
| SMILES | CCCCOCCOCCOCC(N)N |
| InChI | InChI=1S/C10H24N2O3/c1-2-3-4-13-5-6-14-7-8-15-9-10(11)12/h10H,2-9,11-12H2,1H3 |
| InChIKey | CZCBYSYNOMYNMR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|