C18H26O2 — CID 22901866
5,7-ditert-butyl-3,3-dimethyl-1-benzofuran-2-one (PubChem CID 22901866) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 5,7-ditert-butyl-3,3-dimethyl-1-benzofuran-2-one.
| Compound Name | 5,7-ditert-butyl-3,3-dimethyl-1-benzofuran-2-one |
|---|---|
| PubChem CID | 22901866 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5,7-ditert-butyl-3,3-dimethyl-1-benzofuran-2-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)C(C)(C)C(=O)O2 |
| InChI | InChI=1S/C18H26O2/c1-16(2,3)11-9-12(17(4,5)6)14-13(10-11)18(7,8)15(19)20-14/h9-10H,1-8H3 |
| InChIKey | NEEFZGCWSFWXQZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|