C19H25N3O10S3 — CID 22902019
2,3-dihydroxybutanedioic acid;1,1-dioxo-2-phenyl-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 22902019) has the molecular formula C19H25N3O10S3 and a molecular weight of 551.62 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;1,1-dioxo-2-phenyl-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | 2,3-dihydroxybutanedioic acid;1,1-dioxo-2-phenyl-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 22902019 |
| Molecular Formula | C19H25N3O10S3 |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;1,1-dioxo-2-phenyl-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCCNC1CN(c2ccccc2)S(=O)(=O)c2sc(S(N)(=O)=O)cc21.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C15H19N3O4S3.C4H6O6/c1-2-8-17-13-10-18(11-6-4-3-5-7-11)25(21,22)15-12(13)9-14(23-15)24(16,19)20;5-1(3(7)8)2(6)4(9)10/h3-7,9,13,17H,2,8,10H2,1H3,(H2,16,19,20);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | SSKXGIQUJFNVOV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 224.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |