C10H16N2 — CID 22902208
N,N-dimethyl-1,2,3,7a-tetrahydroisoindol-3a-amine (PubChem CID 22902208) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N,N-dimethyl-1,2,3,7a-tetrahydroisoindol-3a-amine.
| Compound Name | N,N-dimethyl-1,2,3,7a-tetrahydroisoindol-3a-amine |
|---|---|
| PubChem CID | 22902208 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N,N-dimethyl-1,2,3,7a-tetrahydroisoindol-3a-amine |
| SMILES | CN(C)C12C=CC=CC1CNC2 |
| InChI | InChI=1S/C10H16N2/c1-12(2)10-6-4-3-5-9(10)7-11-8-10/h3-6,9,11H,7-8H2,1-2H3 |
| InChIKey | WKYQTWSIXBTRFY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |