C9H14N2 — CID 22902211
N-methyl-1,2,3,7a-tetrahydroisoindol-3a-amine (PubChem CID 22902211) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-methyl-1,2,3,7a-tetrahydroisoindol-3a-amine.
| Compound Name | N-methyl-1,2,3,7a-tetrahydroisoindol-3a-amine |
|---|---|
| PubChem CID | 22902211 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-methyl-1,2,3,7a-tetrahydroisoindol-3a-amine |
| SMILES | CNC12C=CC=CC1CNC2 |
| InChI | InChI=1S/C9H14N2/c1-10-9-5-3-2-4-8(9)6-11-7-9/h2-5,8,10-11H,6-7H2,1H3 |
| InChIKey | NYGOKRSIGCKLLX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |