C17H11ClF7NO2 — CID 2290267
4-chloro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 2290267) has the molecular formula C17H11ClF7NO2 and a molecular weight of 429.72 g/mol. Its IUPAC name is 4-chloro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2290267 |
| Molecular Formula | C17H11ClF7NO2 |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 4-chloro-N-[4-(2,2,3,3-tetrafluoropropoxy)-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)C(F)F)c(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClF7NO2/c18-10-3-1-9(2-4-10)14(27)26-11-5-6-13(12(7-11)17(23,24)25)28-8-16(21,22)15(19)20/h1-7,15H,8H2,(H,26,27) |
| InChIKey | ITNHXBIEOHMRCY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|